EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31F5N4O |
| Net Charge | 0 |
| Average Mass | 522.562 |
| Monoisotopic Mass | 522.24180 |
| SMILES | C[C@@H]1Cc2c(nc3ccccc23)[C@@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)N1CC(F)(F)CO |
| InChI | InChI=1S/C27H31F5N4O/c1-16-9-20-19-5-2-3-6-23(19)34-25(20)26(36(16)14-27(31,32)15-37)24-21(29)10-17(11-22(24)30)33-18-12-35(13-18)8-4-7-28/h2-3,5-6,10-11,16,18,26,33-34,37H,4,7-9,12-15H2,1H3/t16-,26-/m1/s1 |
| InChIKey | GQCXHIKRWBIQMD-AKJBCIBTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| giredestrant (CHEBI:758216) has role antineoplastic agent (CHEBI:35610) |
| giredestrant (CHEBI:758216) is a harmala alkaloid (CHEBI:61379) |
| INN | Source |
|---|---|
| giredestrant | WHO MedNet |
| Synonyms | Source |
|---|---|
| GDC-9545 | ChEMBL |
| RO-7197597 | ChEMBL |
| RO7197597 | ChEMBL |
| Citations |
|---|