EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H38ClF3N2O6S2 |
| Net Charge | 0 |
| Average Mass | 823.355 |
| Monoisotopic Mass | 822.18119 |
| SMILES | O=C(O)CCc1ccc(S(=O)(=O)CCc2c(CCNS(=O)(=O)Cc3ccccc3C(F)(F)F)n(C(c3ccccc3)c3ccccc3)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C42H38ClF3N2O6S2/c43-33-18-21-38-36(27-33)35(24-26-55(51,52)34-19-15-29(16-20-34)17-22-40(49)50)39(48(38)41(30-9-3-1-4-10-30)31-11-5-2-6-12-31)23-25-47-56(53,54)28-32-13-7-8-14-37(32)42(44,45)46/h1-16,18-21,27,41,47H,17,22-26,28H2,(H,49,50) |
| InChIKey | HWNIPKHEEVNHMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-5212372 (CHEBI:758213) has role dermatologic drug (CHEBI:50177) |
| pf-5212372 (CHEBI:758213) is a diarylmethane (CHEBI:51614) |
| Synonyms | Source |
|---|---|
| PF-05212372 | ChEMBL |
| PF-5212372 | ChEMBL |
| PLA-950 | ChEMBL |
| ZPL-521 | ChEMBL |
| ZPL 5212372 | ChEMBL |
| ZPL-5212372 | ChEMBL |