EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO3 |
| Net Charge | 0 |
| Average Mass | 271.316 |
| Monoisotopic Mass | 271.12084 |
| SMILES | O=c1ccc2ccc(O[C@@H]3C[C@H]4CC[C@@H](C3)N4)cc2o1 |
| InChI | InChI=1S/C16H17NO3/c18-16-6-2-10-1-5-13(9-15(10)20-16)19-14-7-11-3-4-12(8-14)17-11/h1-2,5-6,9,11-12,14,17H,3-4,7-8H2/t11-,12+,14- |
| InChIKey | PGUDASZQLOAZRX-DABQJJPHSA-N |
| Roles Classification |
|---|
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ip-2018 (CHEBI:758211) has role vasodilator agent (CHEBI:35620) |
| ip-2018 (CHEBI:758211) is a coumarins (CHEBI:23403) |
| Synonyms | Source |
|---|---|
| IP-2018 | ChEMBL |
| IP2018 | ChEMBL |