EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O13 |
| Net Charge | 0 |
| Average Mass | 480.378 |
| Monoisotopic Mass | 480.09039 |
| SMILES | O=c1c(O[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2O)c(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15,17-18,21-28,30-31H,5H2/t12-,15-,17+,18-,21-/m0/s1 |
| InChIKey | FOHXFLPXBUAOJM-UPPCLWNPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myricetin 3-O-α-L-glucopyranoside (CHEBI:75821) has functional parent α-L-glucose (CHEBI:37630) |
| myricetin 3-O-α-L-glucopyranoside (CHEBI:75821) has role metabolite (CHEBI:25212) |
| myricetin 3-O-α-L-glucopyranoside (CHEBI:75821) is a monosaccharide derivative (CHEBI:63367) |
| myricetin 3-O-α-L-glucopyranoside (CHEBI:75821) is a myricetin O-glucoside (CHEBI:75812) |
| myricetin 3-O-α-L-glucopyranoside (CHEBI:75821) is a pentahydroxyflavone (CHEBI:25883) |
| myricetin 3-O-α-L-glucopyranoside (CHEBI:75821) is a α-L-glucoside (CHEBI:71351) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl α-L-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1445032 | Reaxys |