EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23N3O3 |
| Net Charge | 0 |
| Average Mass | 329.400 |
| Monoisotopic Mass | 329.17394 |
| SMILES | Cc1cccc(OC2CCN(Cc3cc(=O)nc(=O)n3)CC2)c1C |
| InChI | InChI=1S/C18H23N3O3/c1-12-4-3-5-16(13(12)2)24-15-6-8-21(9-7-15)11-14-10-17(22)20-18(23)19-14/h3-5,10,15H,6-9,11H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | AZOFJHATIPDIER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-2556286 (CHEBI:758209) has role antitubercular agent (CHEBI:33231) |
| gsk-2556286 (CHEBI:758209) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| GSK-2556286 | ChEMBL |
| GSK2556286 | ChEMBL |
| GSK2556286A | ChEMBL |
| Gsk-286 | ChEMBL |
| Citations |
|---|