EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13F2NO2 |
| Net Charge | 0 |
| Average Mass | 181.182 |
| Monoisotopic Mass | 181.09144 |
| SMILES | CC(C)(C[C@H](N)C(=O)O)C(F)F |
| InChI | InChI=1S/C7H13F2NO2/c1-7(2,6(8)9)3-4(10)5(11)12/h4,6H,3,10H2,1-2H3,(H,11,12)/t4-/m0/s1 |
| InChIKey | HRFIMCJTDKEPPV-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nv-5138 (CHEBI:758204) has role antidepressant (CHEBI:35469) |
| nv-5138 (CHEBI:758204) is a leucine derivative (CHEBI:47003) |
| Synonyms | Source |
|---|---|
| NV-5138 | ChEMBL |
| NV5138 | ChEMBL |