EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O6 |
| Net Charge | 0 |
| Average Mass | 360.366 |
| Monoisotopic Mass | 360.13214 |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N2O6/c1-5-26-18(22)15-11(3)19-10(2)14(17(21)25-4)16(15)12-7-6-8-13(9-12)20(23)24/h6-9,16,19H,5H2,1-4H3 |
| InChIKey | PVHUJELLJLJGLN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrendipine (CHEBI:7582) has role antihypertensive agent (CHEBI:35674) |
| nitrendipine (CHEBI:7582) has role calcium channel blocker (CHEBI:38215) |
| nitrendipine (CHEBI:7582) has role geroprotector (CHEBI:176497) |
| nitrendipine (CHEBI:7582) has role vasodilator agent (CHEBI:35620) |
| nitrendipine (CHEBI:7582) is a C-nitro compound (CHEBI:35716) |
| nitrendipine (CHEBI:7582) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| nitrendipine (CHEBI:7582) is a diester (CHEBI:51307) |
| nitrendipine (CHEBI:7582) is a dihydropyridine (CHEBI:50075) |
| nitrendipine (CHEBI:7582) is a ethyl ester (CHEBI:23990) |
| nitrendipine (CHEBI:7582) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| nitrendipine | ChemIDplus |
| nitrendipino | ChemIDplus |
| nitrendipinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid ethyl methyl ester | ChemIDplus |
| BAY e 5009 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Bayotensin | ChemIDplus |
| Baypress | KEGG DRUG |
| Bylotensin | ChEBI |
| Deiten | ChEBI |
| Nidrel | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1947 | DrugCentral |
| C07713 | KEGG COMPOUND |
| CN101416954 | Patent |
| D00629 | KEGG DRUG |
| DB01054 | DrugBank |
| DE2117571 | Patent |
| HMDB0015187 | HMDB |
| LSM-1246 | LINCS |
| Nitrendipine | Wikipedia |
| US3799934 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:498823 | Reaxys |
| CAS:39562-70-4 | KEGG COMPOUND |
| CAS:39562-70-4 | NIST Chemistry WebBook |
| Citations |
|---|