EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O6 |
| Net Charge | 0 |
| Average Mass | 360.366 |
| Monoisotopic Mass | 360.13214 |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N2O6/c1-5-26-18(22)15-11(3)19-10(2)14(17(21)25-4)16(15)12-7-6-8-13(9-12)20(23)24/h6-9,16,19H,5H2,1-4H3 |
| InChIKey | PVHUJELLJLJGLN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitrendipine (CHEBI:7582) has role antihypertensive agent (CHEBI:35674) |
| nitrendipine (CHEBI:7582) has role calcium channel blocker (CHEBI:38215) |
| nitrendipine (CHEBI:7582) has role geroprotector (CHEBI:176497) |
| nitrendipine (CHEBI:7582) has role vasodilator agent (CHEBI:35620) |
| nitrendipine (CHEBI:7582) is a C-nitro compound (CHEBI:35716) |
| nitrendipine (CHEBI:7582) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| nitrendipine (CHEBI:7582) is a diester (CHEBI:51307) |
| nitrendipine (CHEBI:7582) is a dihydropyridine (CHEBI:50075) |
| nitrendipine (CHEBI:7582) is a ethyl ester (CHEBI:23990) |
| nitrendipine (CHEBI:7582) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| nitrendipine | ChemIDplus |
| nitrendipino | ChemIDplus |
| nitrendipinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid ethyl methyl ester | ChemIDplus |
| BAY e 5009 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Bayotensin | ChemIDplus |
| Baypress | KEGG DRUG |
| Bylotensin | ChEBI |
| Deiten | ChEBI |
| Nidrel | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1947 | DrugCentral |
| C07713 | KEGG COMPOUND |
| CN101416954 | Patent |
| D00629 | KEGG DRUG |
| DB01054 | DrugBank |
| DE2117571 | Patent |
| HMDB0015187 | HMDB |
| LSM-1246 | LINCS |
| Nitrendipine | Wikipedia |
| US3799934 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:498823 | Reaxys |
| CAS:39562-70-4 | KEGG COMPOUND |
| CAS:39562-70-4 | NIST Chemistry WebBook |
| Citations |
|---|