EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N8O2 |
| Net Charge | 0 |
| Average Mass | 530.677 |
| Monoisotopic Mass | 530.31177 |
| SMILES | CCCNc1nc(Nc2ccc(C#N)cc2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C29H38N8O2/c1-6-17-31-27-24(21-33-29(35-27)34-25-15-13-23(20-30)14-16-25)11-8-7-9-18-32-28(39)22(2)37(5)26(38)12-10-19-36(3)4/h10,12-16,21-22H,6-7,9,17-19H2,1-5H3,(H,32,39)(H2,31,33,34,35)/b12-10+/t22-/m0/s1 |
| InChIKey | HJFSVYUFOXAVAA-YUAYGMJFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ff-10101 (CHEBI:758188) has role antineoplastic agent (CHEBI:35610) |
| ff-10101 (CHEBI:758188) is a alanine derivative (CHEBI:22278) |
| Synonyms | Source |
|---|---|
| Ff-10101 | ChEMBL |
| FLT3-IN-1 | ChEMBL |
| Citations |
|---|