EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H29ClN6O4 |
| Net Charge | 0 |
| Average Mass | 561.042 |
| Monoisotopic Mass | 560.19388 |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)ncnc2cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C29H29ClN6O4/c1-2-28(37)35-25-16-22-24(17-27(25)39-14-11-36-9-12-38-13-10-36)32-19-33-29(22)34-20-6-7-26(23(30)15-20)40-18-21-5-3-4-8-31-21/h2-8,15-17,19H,1,9-14,18H2,(H,35,37)(H,32,33,34) |
| InChIKey | HIBPKFXWOPYJPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tuxobertinib (CHEBI:758185) has role antineoplastic agent (CHEBI:35610) |
| tuxobertinib (CHEBI:758185) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| tuxobertinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BDTX-189 | ChEMBL |
| BDTX189 | ChEMBL |
| Citations |
|---|