EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36F3N9O |
| Net Charge | 0 |
| Average Mass | 571.652 |
| Monoisotopic Mass | 571.29949 |
| SMILES | CC(C)(C)NCCNc1ccc(C2=NN=C(C(F)(F)F)C2)nc1C1CCN(c2ncnc3c2C(C)(C)C(=O)N3)CC1 |
| InChI | InChI=1S/C28H36F3N9O/c1-26(2,3)35-11-10-32-18-7-6-17(19-14-20(39-38-19)28(29,30)31)36-22(18)16-8-12-40(13-9-16)24-21-23(33-15-34-24)37-25(41)27(21,4)5/h6-7,15-16,32,35H,8-14H2,1-5H3,(H,33,34,37,41) |
| InChIKey | UVKWCPOZHXNKAZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tas0612 (CHEBI:758183) has role antineoplastic agent (CHEBI:35610) |
| tas0612 (CHEBI:758183) is a pyrrolopyrimidine (CHEBI:38670) |
| Synonym | Source |
|---|---|
| Tas0612 | ChEMBL |