EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H17Cl2F6N3O3S |
| Net Charge | 0 |
| Average Mass | 588.357 |
| Monoisotopic Mass | 587.02719 |
| SMILES | O=C(CNC(=O)c1sc(C2=NO[C@@](c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)c2c1CCC2)NCC(F)F |
| InChI | InChI=1S/C22H17Cl2F6N3O3S/c23-12-4-9(5-13(24)17(12)27)21(22(28,29)30)6-14(33-36-21)18-10-2-1-3-11(10)19(37-18)20(35)32-8-16(34)31-7-15(25)26/h4-5,15H,1-3,6-8H2,(H,31,34)(H,32,35)/t21-/m0/s1 |
| InChIKey | OFGKIOOXISVXEC-NRFANRHFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mivorilaner (CHEBI:758139) has role antiparasitic agent (CHEBI:35442) |
| mivorilaner (CHEBI:758139) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| ITABH-19-01 | ChEMBL |
| LY-3116151 | ChEMBL |
| LY3116151 | ChEMBL |
| Mivorilaner | ChEMBL |