EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N3O |
| Net Charge | 0 |
| Average Mass | 259.353 |
| Monoisotopic Mass | 259.16846 |
| SMILES | CN1CCC2(CC1)NCC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C15H21N3O/c1-17-9-7-15(8-10-17)16-11-14(19)18(15)12-13-5-3-2-4-6-13/h2-6,16H,7-12H2,1H3 |
| InChIKey | BSQPTZYKCAULBH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| simufilam (CHEBI:758136) has role anti-inflammatory agent (CHEBI:67079) |
| simufilam (CHEBI:758136) has role antineoplastic agent (CHEBI:35610) |
| simufilam (CHEBI:758136) is a azaspiro compound (CHEBI:35624) |
| INN | Source |
|---|---|
| simufilam | WHO MedNet |
| Synonyms | Source |
|---|---|
| C-0105 | ChEMBL |
| C0105 | ChEMBL |
| C0105M | ChEMBL |
| PTI-125 | ChEMBL |
| PTI-910 | ChEMBL |
| Brand Name | Source |
|---|---|
| Filora | ChEMBL |