EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H57ClN4O5S |
| Net Charge | 0 |
| Average Mass | 765.461 |
| Monoisotopic Mass | 764.37382 |
| SMILES | [H][C@]12CCCCN1CCN(C[C@@]1(OC)/C=C/C[C@H](C)[C@@H](C)S(=O)(=O)NC(=O)c3ccc4c(c3)N(C[C@@]3(CCCc5cc(Cl)ccc53)CO4)C[C@]3([H])CC[C@]31[H])C2 |
| InChI | InChI=1S/C42H57ClN4O5S/c1-29-8-6-18-42(51-3,27-45-20-21-46-19-5-4-10-35(46)25-45)37-14-11-33(37)24-47-26-41(17-7-9-31-22-34(43)13-15-36(31)41)28-52-39-16-12-32(23-38(39)47)40(48)44-53(49,50)30(29)2/h6,12-13,15-16,18,22-23,29-30,33,35,37H,4-5,7-11,14,17,19-21,24-28H2,1-3H3,(H,44,48)/b18-6+/t29-,30+,33-,35+,37+,41-,42-/m0/s1 |
| InChIKey | BJTFTQIBRVBSBH-VCQPVEJUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| murizatoclax (CHEBI:758131) has role antineoplastic agent (CHEBI:35610) |
| murizatoclax (CHEBI:758131) is a organic heterobicyclic compound (CHEBI:27171) |
| murizatoclax (CHEBI:758131) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| INN | Source |
|---|---|
| murizatoclax | WHO MedNet |
| Synonyms | Source |
|---|---|
| AMG 397 | ChEMBL |
| AMG-397 | ChEMBL |
| Citations |
|---|