EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11NO3.C31H30FN5O4 |
| Net Charge | 0 |
| Average Mass | 676.746 |
| Monoisotopic Mass | 676.30208 |
| SMILES | N#Cc1ccc(COc2cccc(C3CCN(Cc4nc5ccc(C(=O)O)cc5n4C[C@@H]4CCO4)CC3)n2)c(F)c1.NC(CO)(CO)CO |
| InChI | InChI=1S/C31H30FN5O4.C4H11NO3/c32-25-14-20(16-33)4-5-23(25)19-41-30-3-1-2-26(35-30)21-8-11-36(12-9-21)18-29-34-27-7-6-22(31(38)39)15-28(27)37(29)17-24-10-13-40-24;5-4(1-6,2-7)3-8/h1-7,14-15,21,24H,8-13,17-19H2,(H,38,39);6-8H,1-3,5H2/t24-;/m0./s1 |
| InChIKey | JEJPAGACGZQFHN-JIDHJSLPSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| danuglipron tromethamine (CHEBI:758125) has role anti-obesity agent (CHEBI:74518) |
| danuglipron tromethamine (CHEBI:758125) has role hypoglycemic agent (CHEBI:35526) |
| danuglipron tromethamine (CHEBI:758125) is a benzimidazoles (CHEBI:22715) |
| Synonyms | Source |
|---|---|
| Danuglipron tromethamine | ChEMBL |
| PF-06882961-82 | ChEMBL |
| PF-06882961 tromethamine | ChEMBL |