EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H38F2N8O |
| Net Charge | 0 |
| Average Mass | 576.696 |
| Monoisotopic Mass | 576.31366 |
| SMILES | CN1CCC(c2ccccc2CC(C)(C)Nc2nc(N3CCOCC3)nc(-n3c(C(F)F)nc4ccccc43)n2)CC1 |
| InChI | InChI=1S/C31H38F2N8O/c1-31(2,20-22-8-4-5-9-23(22)21-12-14-39(3)15-13-21)38-28-35-29(40-16-18-42-19-17-40)37-30(36-28)41-25-11-7-6-10-24(25)34-27(41)26(32)33/h4-11,21,26H,12-20H2,1-3H3,(H,35,36,37,38) |
| InChIKey | WPFUFWIHMYZXSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zandelisib (CHEBI:758121) has role antineoplastic agent (CHEBI:35610) |
| zandelisib (CHEBI:758121) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| zandelisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACC-524 | ChEMBL |
| ME-401 | ChEMBL |
| PW-143 | ChEMBL |
| PWT-143 | ChEMBL |
| PWT143 | ChEMBL |