EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H30FN5O4 |
| Net Charge | 0 |
| Average Mass | 567.621 |
| Monoisotopic Mass | 567.22818 |
| SMILES | N#Cc1ccc(N2CCN(Cc3ccc(COc4cccc5c4CN([C@H]4CCC(=O)NC4=O)C5=O)cc3)CC2)c(F)c1 |
| InChI | InChI=1S/C32H30FN5O4/c33-26-16-23(17-34)8-9-27(26)37-14-12-36(13-15-37)18-21-4-6-22(7-5-21)20-42-29-3-1-2-24-25(29)19-38(32(24)41)28-10-11-30(39)35-31(28)40/h1-9,16,28H,10-15,18-20H2,(H,35,39,40)/t28-/m0/s1 |
| InChIKey | YTINZZFBHWSAGL-NDEPHWFRSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mezigdomide (CHEBI:758118) has role antineoplastic agent (CHEBI:35610) |
| mezigdomide (CHEBI:758118) has role renoprotective agent (CHEBI:231911) |
| mezigdomide (CHEBI:758118) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| mezigdomide | WHO MedNet |
| Synonyms | Source |
|---|---|
| CC-92480 | ChEMBL |
| CC92480 | ChEMBL |
| Citations |
|---|