EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N7O |
| Net Charge | 0 |
| Average Mass | 375.436 |
| Monoisotopic Mass | 375.18076 |
| SMILES | C[C@@H]1COCCN1c1cc(-c2ccnn2C)c2ccnc(-c3ccnn3)c2n1 |
| InChI | InChI=1S/C20H21N7O/c1-13-12-28-10-9-27(13)18-11-15(17-5-8-23-26(17)2)14-3-6-21-20(19(14)24-18)16-4-7-22-25-16/h3-8,11,13H,9-10,12H2,1-2H3,(H,22,25)/t13-/m1/s1 |
| InChIKey | YBXRSCXGRPSTMW-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elimusertib (CHEBI:758117) has role antineoplastic agent (CHEBI:35610) |
| elimusertib (CHEBI:758117) is a naphthyridine derivative (CHEBI:73539) |
| INN | Source |
|---|---|
| elimusertib | WHO MedNet |
| Synonym | Source |
|---|---|
| BAY-1895344 | ChEMBL |
| Citations |
|---|