EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H57N7O6 |
| Net Charge | 0 |
| Average Mass | 791.994 |
| Monoisotopic Mass | 791.43703 |
| SMILES | O=C1c2cc(-c3ccc(CN4CCCC4)cc3)c3c4c(cc(NCCN5CCCC5)c(c24)C(=O)N1CCCN1CCOCC1)C(=O)N(CCCN1CCOCC1)C3=O |
| InChI | InChI=1S/C45H57N7O6/c53-42-35-29-34(33-9-7-32(8-10-33)31-50-14-3-4-15-50)40-38-36(43(54)51(44(40)55)18-5-16-48-21-25-57-26-22-48)30-37(46-11-20-47-12-1-2-13-47)41(39(35)38)45(56)52(42)19-6-17-49-23-27-58-28-24-49/h7-10,29-30,46H,1-6,11-28,31H2 |
| InChIKey | JQXVCGMANURRRW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| qn-302 (CHEBI:758113) has role antineoplastic agent (CHEBI:35610) |
| qn-302 (CHEBI:758113) is a benzenes (CHEBI:22712) |
| qn-302 (CHEBI:758113) is a naphthalenes (CHEBI:25477) |
| qn-302 (CHEBI:758113) is a ring assembly (CHEBI:36820) |
| Synonyms | Source |
|---|---|
| Qn-302 | ChEMBL |
| QN302 | ChEMBL |
| SOP-1812 | ChEMBL |
| SOP1812 | ChEMBL |
| Citations |
|---|