EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H52O7P2 |
| Net Charge | 0 |
| Average Mass | 562.665 |
| Monoisotopic Mass | 562.31883 |
| SMILES | CC(C)OP(=O)(OC(C)C)C(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C28H52O7P2/c1-18(2)32-36(30,33-19(3)4)25(37(31,34-20(5)6)35-21(7)8)17-22-15-23(27(9,10)11)26(29)24(16-22)28(12,13)14/h15-16,18-21,25,29H,17H2,1-14H3 |
| InChIKey | YLJOVCWVJCDPLN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apomine (CHEBI:758112) has role antineoplastic agent (CHEBI:35610) |
| apomine (CHEBI:758112) has role bone density conservation agent (CHEBI:50646) |
| apomine (CHEBI:758112) is a 1,1-bis(phosphonic acid) (CHEBI:77383) |
| Synonyms | Source |
|---|---|
| Apomine | ChEMBL |
| SR-45023A | ChEMBL |
| SR 9223I | ChEMBL |
| SR-9223I | ChEMBL |
| Citations |
|---|