EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:758109 - xeruborbactam
| Formula | C10H8BFO4 |
| Net Charge | 0 |
| Average Mass | 221.980 |
| Monoisotopic Mass | 222.04997 |
| SMILES | [H][C@@]12C[C@]1([H])c1ccc(F)c(C(=O)O)c1OB2O |
| InChI | InChI=1S/C10H8BFO4/c12-7-2-1-4-5-3-6(5)11(15)16-9(4)8(7)10(13)14/h1-2,5-6,15H,3H2,(H,13,14)/t5-,6-/m1/s1 |
| InChIKey | KOHUFVUIYUCFNG-PHDIDXHHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xeruborbactam (CHEBI:758109) has role antibacterial agent (CHEBI:33282) |
| xeruborbactam (CHEBI:758109) is a aromatic carboxylic acid (CHEBI:33859) |
| xeruborbactam (CHEBI:758109) is a organohalogen compound (CHEBI:17792) |
| Synonyms | Source |
|---|---|
| QPX-7728 | ChEMBL |
| QPX7728 | ChEMBL |
| Xeruborbactam | ChEMBL |
| Citations |
|---|