EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34ClN3O4 |
| Net Charge | 0 |
| Average Mass | 488.028 |
| Monoisotopic Mass | 487.22378 |
| SMILES | [H][C@]1([C@@]2(C)Oc3c(Cl)cc(C(=O)NCc4c(C)cc(C)nc4=O)c(C)c3O2)CC[C@H](N(C)C)CC1 |
| InChI | InChI=1S/C26H34ClN3O4/c1-14-11-15(2)29-25(32)20(14)13-28-24(31)19-12-21(27)23-22(16(19)3)33-26(4,34-23)17-7-9-18(10-8-17)30(5)6/h11-12,17-18H,7-10,13H2,1-6H3,(H,28,31)(H,29,32)/t17-,18-,26-/m1/s1 |
| InChIKey | SSDRNUPMYCFXGM-UYPAYLBCSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valemetostat (CHEBI:758103) has role antineoplastic agent (CHEBI:35610) |
| valemetostat (CHEBI:758103) is a benzodioxoles (CHEBI:38298) |
| INN | Source |
|---|---|
| valemetostat | WHO MedNet |
| Citations |
|---|