EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21FN6O2 |
| Net Charge | 0 |
| Average Mass | 408.437 |
| Monoisotopic Mass | 408.17100 |
| SMILES | O=C(NCc1ncccc1F)c1coc(CCNCCc2nc3ccccc3n2)n1 |
| InChI | InChI=1S/C21H21FN6O2/c22-14-4-3-9-24-17(14)12-25-21(29)18-13-30-20(28-18)8-11-23-10-7-19-26-15-5-1-2-6-16(15)27-19/h1-6,9,13,23H,7-8,10-12H2,(H,25,29)(H,26,27) |
| InChIKey | KNYVRFXIVWUGBZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vamifeport (CHEBI:758099) has role anti-anaemic agent (CHEBI:75835) |
| vamifeport (CHEBI:758099) is a benzimidazoles (CHEBI:22715) |
| Synonyms | Source |
|---|---|
| Vamifeport | ChEMBL |
| VIT-2763 | ChEMBL |
| VIT- 2763-PM1 | ChEMBL |
| VIT-2763-PM1 | ChEMBL |