EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O14 |
| Net Charge | 0 |
| Average Mass | 494.361 |
| Monoisotopic Mass | 494.06966 |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2cc(O)c3c(=O)c(O)c(-c4cc(O)c(O)c(O)c4)oc3c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H18O14/c22-7-3-6(33-21-17(30)14(27)16(29)19(35-21)20(31)32)4-10-11(7)13(26)15(28)18(34-10)5-1-8(23)12(25)9(24)2-5/h1-4,14,16-17,19,21-25,27-30H,(H,31,32)/t14-,16-,17+,19-,21+/m0/s1 |
| InChIKey | VNDJCGMKSHKEIZ-JENRNSKYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myricetin 7-O-glucuronide (CHEBI:75809) has role metabolite (CHEBI:25212) |
| myricetin 7-O-glucuronide (CHEBI:75809) is a flavonols (CHEBI:28802) |
| myricetin 7-O-glucuronide (CHEBI:75809) is a monosaccharide derivative (CHEBI:63367) |
| myricetin 7-O-glucuronide (CHEBI:75809) is a myricetin O-glucuronide (CHEBI:75806) |
| myricetin 7-O-glucuronide (CHEBI:75809) is a pentahydroxyflavone (CHEBI:25883) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-7-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| myricetin 7-O-β-D-glucopyranosiduronic acid | ChEBI |
| myricetin 7-O-β-D-glucoronopyranoside | ChEBI |