EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17-,18-,21+/m1/s1 |
| InChIKey | JPUKWEQWGBDDQB-IDRAQACASA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 3-O-β-D-allopyranoside (CHEBI:75796) has functional parent kaempferol (CHEBI:28499) |
| kaempferol 3-O-β-D-allopyranoside (CHEBI:75796) has functional parent β-D-allose (CHEBI:40656) |
| kaempferol 3-O-β-D-allopyranoside (CHEBI:75796) has role metabolite (CHEBI:25212) |
| kaempferol 3-O-β-D-allopyranoside (CHEBI:75796) has role plant metabolite (CHEBI:76924) |
| kaempferol 3-O-β-D-allopyranoside (CHEBI:75796) is a glycosyloxyflavone (CHEBI:50018) |
| kaempferol 3-O-β-D-allopyranoside (CHEBI:75796) is a monosaccharide derivative (CHEBI:63367) |
| kaempferol 3-O-β-D-allopyranoside (CHEBI:75796) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl β-D-allopyranoside |
| Synonym | Source |
|---|---|
| asiaticalin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1359974 | Reaxys |