EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18FNO3S |
| Net Charge | 0 |
| Average Mass | 275.345 |
| Monoisotopic Mass | 275.09914 |
| SMILES | CCCNCCOc1cc(F)cc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H18FNO3S/c1-3-4-14-5-6-17-11-7-10(13)8-12(9-11)18(2,15)16/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | OSBPYFBXSLJHCR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesdopetam (CHEBI:757932) has role antiparkinson drug (CHEBI:48407) |
| mesdopetam (CHEBI:757932) is a sulfonic acid derivative (CHEBI:33552) |
| INN | Source |
|---|---|
| mesdopetam | WHO MedNet |
| Synonyms | Source |
|---|---|
| IRL-790 | ChEMBL |
| IRL790 | ChEMBL |