EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9Cl2NO4S |
| Net Charge | 0 |
| Average Mass | 358.202 |
| Monoisotopic Mass | 356.96293 |
| SMILES | O=C(c1cc(Cl)c(O)c(Cl)c1)N1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H9Cl2NO4S/c15-9-5-8(6-10(16)13(9)18)14(19)17-7-22(20,21)12-4-2-1-3-11(12)17/h1-6,18H,7H2 |
| InChIKey | VOFLAIHEELWYGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dotinurad (CHEBI:757931) has role gout suppressant (CHEBI:35845) |
| dotinurad (CHEBI:757931) is a carbonyl compound (CHEBI:36586) |
| dotinurad (CHEBI:757931) is a organohalogen compound (CHEBI:17792) |
| INN | Source |
|---|---|
| dotinurad | WHO MedNet |
| Synonym | Source |
|---|---|
| FYU-981 | ChEMBL |
| Citations |
|---|