EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17F3N2O3S |
| Net Charge | 0 |
| Average Mass | 410.417 |
| Monoisotopic Mass | 410.09120 |
| SMILES | CNCc1cn(S(=O)(=O)c2cccc(F)c2)c(-c2ccc(F)cc2F)c1OC |
| InChI | InChI=1S/C19H17F3N2O3S/c1-23-10-12-11-24(28(25,26)15-5-3-4-13(20)8-15)18(19(12)27-2)16-7-6-14(21)9-17(16)22/h3-9,11,23H,10H2,1-2H3 |
| InChIKey | OUNXGNDVWVPCOL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abeprazan (CHEBI:757930) has role anti-ulcer drug (CHEBI:49201) |
| abeprazan (CHEBI:757930) is a sulfonamide (CHEBI:35358) |
| INN | Source |
|---|---|
| abeprazan | WHO MedNet |
| Synonyms | Source |
|---|---|
| DWP-14012 | ChEMBL |
| DWP14012 | ChEMBL |
| Fexuprazan | ChEMBL |