EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11ClFN5 |
| Net Charge | 0 |
| Average Mass | 315.739 |
| Monoisotopic Mass | 315.06870 |
| SMILES | Cc1cc(-c2nnc(N)nc2-c2ccc(F)cc2)cc(Cl)n1 |
| InChI | InChI=1S/C15H11ClFN5/c1-8-6-10(7-12(16)19-8)14-13(20-15(18)22-21-14)9-2-4-11(17)5-3-9/h2-7H,1H3,(H2,18,20,22) |
| InChIKey | NCWQLHHDGDXIJN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imaradenant (CHEBI:757928) has role antineoplastic agent (CHEBI:35610) |
| imaradenant (CHEBI:757928) is a chloropyridine (CHEBI:39173) |
| INN | Source |
|---|---|
| imaradenant | WHO MedNet |
| Synonyms | Source |
|---|---|
| Azd 4635 | ChEMBL |
| AZD-4635 | ChEMBL |
| AZD4635 | ChEMBL |
| HTL-1071 | ChEMBL |
| HTL1071 | ChEMBL |
| Citations |
|---|