EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18FN5O3 |
| Net Charge | 0 |
| Average Mass | 395.394 |
| Monoisotopic Mass | 395.13937 |
| SMILES | COc1cc(Nc2ncc(C)c(Nc3ccc4oc(=O)nc4c3)n2)cc(C)c1F |
| InChI | InChI=1S/C20H18FN5O3/c1-10-6-13(8-16(28-3)17(10)21)24-19-22-9-11(2)18(26-19)23-12-4-5-15-14(7-12)25-20(27)29-15/h4-9H,1-3H3,(H,25,27)(H2,22,23,24,26) |
| InChIKey | OYFMQDVLFYKOPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ifidancitinib (CHEBI:757927) has role dermatologic drug (CHEBI:50177) |
| ifidancitinib (CHEBI:757927) is a benzoxazole (CHEBI:46700) |
| INN | Source |
|---|---|
| ifidancitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| A-301 | ChEMBL |
| Ati-50002 | ChEMBL |
| ATI50002 | ChEMBL |
| ATI-502 | ChEMBL |
| Citations |
|---|