EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21F2N3OS |
| Net Charge | 0 |
| Average Mass | 401.482 |
| Monoisotopic Mass | 401.13734 |
| SMILES | Fc1cc(F)c2c(c1)C[C@@H](n1c(CCNCc3ccccc3)cnc1=S)CO2 |
| InChI | InChI=1S/C21H21F2N3OS/c22-16-8-15-9-18(13-27-20(15)19(23)10-16)26-17(12-25-21(26)28)6-7-24-11-14-4-2-1-3-5-14/h1-5,8,10,12,18,24H,6-7,9,11,13H2,(H,25,28)/t18-/m1/s1 |
| InChIKey | ZSSLCFLHEFXANG-GOSISDBHSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zamicastat (CHEBI:757926) has role antihypertensive agent (CHEBI:35674) |
| zamicastat (CHEBI:757926) is a 1-benzopyran (CHEBI:38443) |
| INN | Source |
|---|---|
| zamicastat | WHO MedNet |