EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15N3O6S |
| Net Charge | 0 |
| Average Mass | 413.411 |
| Monoisotopic Mass | 413.06816 |
| SMILES | Cc1cc([N+](=O)[O-])c(NS(=O)(=O)c2cccc(C(=O)O)c2)cc1-c1cccnc1 |
| InChI | InChI=1S/C19H15N3O6S/c1-12-8-18(22(25)26)17(10-16(12)14-5-3-7-20-11-14)21-29(27,28)15-6-2-4-13(9-15)19(23)24/h2-11,21H,1H3,(H,23,24) |
| InChIKey | QUQGQIASFYWKAB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alofanib (CHEBI:757923) has role antineoplastic agent (CHEBI:35610) |
| alofanib (CHEBI:757923) is a sulfonamide (CHEBI:35358) |
| INN | Source |
|---|---|
| alofanib | WHO MedNet |