EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16BrN3O |
| Net Charge | 0 |
| Average Mass | 382.261 |
| Monoisotopic Mass | 381.04767 |
| SMILES | C[C@H](NC(=O)/C(C#N)=C/C=C/c1cccc(Br)n1)c1ccccc1 |
| InChI | InChI=1S/C19H16BrN3O/c1-14(15-7-3-2-4-8-15)22-19(24)16(13-21)9-5-10-17-11-6-12-18(20)23-17/h2-12,14H,1H3,(H,22,24)/b10-5+,16-9+/t14-/m0/s1 |
| InChIKey | IVAUEQVCSQZMGV-QIUCFAMLSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mol-4239 (CHEBI:757922) has role antineoplastic agent (CHEBI:35610) |
| mol-4239 (CHEBI:757922) has role antipsoriatic (CHEBI:50748) |
| mol-4239 (CHEBI:757922) is a chloropyridine (CHEBI:39173) |
| Synonyms | Source |
|---|---|
| MOL-4239 | ChEMBL |
| MOL4239 | ChEMBL |
| WP-1220 | ChEMBL |
| WP1220 | ChEMBL |