EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N5O3 |
| Net Charge | 0 |
| Average Mass | 435.528 |
| Monoisotopic Mass | 435.22704 |
| SMILES | CC(C)(O)c1cc(Nc2cc(Oc3cn(C4CC4)nc3C3CCOCC3)ccn2)ccn1 |
| InChI | InChI=1S/C24H29N5O3/c1-24(2,30)21-13-17(5-9-25-21)27-22-14-19(6-10-26-22)32-20-15-29(18-3-4-18)28-23(20)16-7-11-31-12-8-16/h5-6,9-10,13-16,18,30H,3-4,7-8,11-12H2,1-2H3,(H,25,26,27) |
| InChIKey | PNPFMWIDAKQFPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly-3200882 (CHEBI:757920) has role antineoplastic agent (CHEBI:35610) |
| ly-3200882 (CHEBI:757920) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Ly 3200882 | ChEMBL |
| LY-3200882 | ChEMBL |
| LY3200882 | ChEMBL |
| Citations |
|---|