EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N6O3 |
| Net Charge | 0 |
| Average Mass | 474.565 |
| Monoisotopic Mass | 474.23794 |
| SMILES | CNC(=O)c1cccc(-c2ccc3c(N4C5CCC4COC5)nc(N4CCOC[C@@H]4C)nc3n2)c1 |
| InChI | InChI=1S/C26H30N6O3/c1-16-13-34-11-10-31(16)26-29-23-21(24(30-26)32-19-6-7-20(32)15-35-14-19)8-9-22(28-23)17-4-3-5-18(12-17)25(33)27-2/h3-5,8-9,12,16,19-20H,6-7,10-11,13-15H2,1-2H3,(H,27,33)/t16-,19?,20?/m0/s1 |
| InChIKey | LVPBYQVQBZLDAU-DZIBYMRMSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mti-31 (CHEBI:757919) has role antineoplastic agent (CHEBI:35610) |
| mti-31 (CHEBI:757919) is a pyridopyrimidine (CHEBI:38932) |
| Synonyms | Source |
|---|---|
| LXI-15029 | ChEMBL |
| MTI-31 | ChEMBL |
| SCC-31 | ChEMBL |