EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32FN5O2 |
| Net Charge | 0 |
| Average Mass | 477.584 |
| Monoisotopic Mass | 477.25400 |
| SMILES | CC(C)n1c(=O)n(C)c2cnc3cc(F)c(-c4ccc(OCCCN5CCCCC5)nc4)cc3c21 |
| InChI | InChI=1S/C27H32FN5O2/c1-18(2)33-26-21-14-20(22(28)15-23(21)29-17-24(26)31(3)27(33)34)19-8-9-25(30-16-19)35-13-7-12-32-10-5-4-6-11-32/h8-9,14-18H,4-7,10-13H2,1-3H3 |
| InChIKey | VQSZIPCGAGVRRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-1390 (CHEBI:757917) has role antineoplastic agent (CHEBI:35610) |
| azd-1390 (CHEBI:757917) is a imidazoquinoline (CHEBI:38776) |
| Synonyms | Source |
|---|---|
| Azd 1390 | ChEMBL |
| AZD-1390 | ChEMBL |
| AZD1390 | ChEMBL |
| Citations |
|---|