EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19F2N5O4 |
| Net Charge | 0 |
| Average Mass | 407.377 |
| Monoisotopic Mass | 407.14051 |
| SMILES | COc1cc(OC)c(F)c(COc2cnc(Nc3cnn(CCO)c3)nc2)c1F |
| InChI | InChI=1S/C18H19F2N5O4/c1-27-14-5-15(28-2)17(20)13(16(14)19)10-29-12-7-21-18(22-8-12)24-11-6-23-25(9-11)3-4-26/h5-9,26H,3-4,10H2,1-2H3,(H,21,22,24) |
| InChIKey | VDZZYOJYLLNBTD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asp-5878 (CHEBI:757916) has role antineoplastic agent (CHEBI:35610) |
| asp-5878 (CHEBI:757916) is a dimethoxybenzene (CHEBI:51681) |
| Synonyms | Source |
|---|---|
| Asp 5878 | ChEMBL |
| ASP-5878 | ChEMBL |
| ASP5878 | ChEMBL |
| Citations |
|---|