EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H20F4N6O2 |
| Net Charge | 0 |
| Average Mass | 584.533 |
| Monoisotopic Mass | 584.15839 |
| SMILES | N#Cc1ccc(COc2ccc(C#Cc3ccc(C(F)(F)[C@](O)(Cn4cnnn4)c4ccc(F)cc4F)nc3)cc2)cc1 |
| InChI | InChI=1S/C31H20F4N6O2/c32-25-10-13-27(28(33)15-25)30(42,19-41-20-38-39-40-41)31(34,35)29-14-9-23(17-37-29)4-1-21-7-11-26(12-8-21)43-18-24-5-2-22(16-36)3-6-24/h2-3,5-15,17,20,42H,18-19H2/t30-/m0/s1 |
| InChIKey | UDGASIIGNCBLSI-PMERELPUSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vt-1598 (CHEBI:757914) has role antifungal agent (CHEBI:35718) |
| vt-1598 (CHEBI:757914) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| VT-1598 | ChEMBL |
| VT1598 | ChEMBL |
| Citations |
|---|