EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21ClNO8P |
| Net Charge | 0 |
| Average Mass | 481.825 |
| Monoisotopic Mass | 481.06933 |
| SMILES | CN1CC[C@H](c2c(OP(=O)(O)O)cc(O)c3c(=O)cc(-c4ccccc4Cl)oc23)[C@H](O)C1 |
| InChI | InChI=1S/C21H21ClNO8P/c1-23-7-6-12(16(26)10-23)19-18(31-32(27,28)29)9-15(25)20-14(24)8-17(30-21(19)20)11-4-2-3-5-13(11)22/h2-5,8-9,12,16,25-26H,6-7,10H2,1H3,(H2,27,28,29)/t12-,16+/m0/s1 |
| InChIKey | YRNFLVUMZIRYKY-BLLLJJGKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tp-1287 (CHEBI:757911) has role antineoplastic agent (CHEBI:35610) |
| tp-1287 (CHEBI:757911) is a hydroxyflavonoid (CHEBI:71968) |
| Synonyms | Source |
|---|---|
| Alvocidib phosphate | ChEMBL |
| Alvocidib prodrug tp-1287 | ChEMBL |
| Tp 1287 | ChEMBL |
| TP-1287 | ChEMBL |
| TP1287 | ChEMBL |
| Citations |
|---|