EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H13D3F4N4O2S |
| Net Charge | 0 |
| Average Mass | 467.462 |
| Monoisotopic Mass | 467.11184 |
| SMILES | [2H]C([2H])([2H])NC(=O)c1ccc(N2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)cc1F |
| InChI | InChI=1S/C21H16F4N4O2S/c1-20(2)18(31)28(12-5-4-11(10-26)15(8-12)21(23,24)25)19(32)29(20)13-6-7-14(16(22)9-13)17(30)27-3/h4-9H,1-3H3,(H,27,30)/i3D3 |
| InChIKey | WXCXUHSOUPDCQV-HPRDVNIFSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deutenzalutamide (CHEBI:757909) has role antineoplastic agent (CHEBI:35610) |
| deutenzalutamide (CHEBI:757909) has role antiviral agent (CHEBI:22587) |
| deutenzalutamide (CHEBI:757909) is a imidazolidines (CHEBI:38261) |
| INNs | Source |
|---|---|
| deutenzalutamida | WHO MedNet |
| deutenzalutamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Enzalutamide d3 | ChEMBL |
| Hc1119 | ChEMBL |
| HC 1119 | ChEMBL |
| HC-1119 | ChEMBL |