EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H17F4N5O2 |
| Net Charge | 0 |
| Average Mass | 495.436 |
| Monoisotopic Mass | 495.13184 |
| SMILES | Cc1cnc(-c2ccc(-c3ccc(NC(=O)Nc4c(F)cc(F)cc4F)cc3F)c3c2C(=O)NC3)n1 |
| InChI | InChI=1S/C25H17F4N5O2/c1-11-9-30-23(32-11)16-5-4-14(17-10-31-24(35)21(16)17)15-3-2-13(8-18(15)27)33-25(36)34-22-19(28)6-12(26)7-20(22)29/h2-9H,10H2,1H3,(H,30,32)(H,31,35)(H2,33,34,36) |
| InChIKey | MWHHJYUHCZWSLS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luxeptinib (CHEBI:757908) has role antineoplastic agent (CHEBI:35610) |
| luxeptinib (CHEBI:757908) is a isoindoles (CHEBI:24897) |
| INN | Source |
|---|---|
| luxeptinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CG-026806 | ChEMBL |
| CG026806 | ChEMBL |
| CG'806 | ChEMBL |
| CG-806 | ChEMBL |
| CG806 | ChEMBL |