EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40N8O2 |
| Net Charge | 0 |
| Average Mass | 484.649 |
| Monoisotopic Mass | 484.32742 |
| SMILES | CC(=O)N[C@@H]1C[C@H](NC(C)(C)C)CC[C@@H]1N1CC[C@H](Nc2ncnc3cc(C(C)(C)C)nn23)C1=O |
| InChI | InChI=1S/C25H40N8O2/c1-15(34)28-18-12-16(30-25(5,6)7)8-9-19(18)32-11-10-17(22(32)35)29-23-27-14-26-21-13-20(24(2,3)4)31-33(21)23/h13-14,16-19,30H,8-12H2,1-7H3,(H,28,34)(H,26,27,29)/t16-,17+,18-,19+/m1/s1 |
| InChIKey | CMVHFGNTABZQJU-HCXYKTFWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-813160 (CHEBI:757907) has role antineoplastic agent (CHEBI:35610) |
| bms-813160 (CHEBI:757907) has role hypoglycemic agent (CHEBI:35526) |
| bms-813160 (CHEBI:757907) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Bms 813160 | ChEMBL |
| BMS-813160 | ChEMBL |
| Citations |
|---|