EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:757906 - surlorian
| Formula | C18H19NO3S |
| Net Charge | 0 |
| Average Mass | 329.421 |
| Monoisotopic Mass | 329.10856 |
| SMILES | COc1ccc2c(c1)CN(Cc1ccc(C(=O)O)cc1)CCS2 |
| InChI | InChI=1S/C18H19NO3S/c1-22-16-6-7-17-15(10-16)12-19(8-9-23-17)11-13-2-4-14(5-3-13)18(20)21/h2-7,10H,8-9,11-12H2,1H3,(H,20,21) |
| InChIKey | JIGDAUOKKYKRKO-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| surlorian (CHEBI:757906) is a benzothiazepine (CHEBI:48684) |
| INN | Source |
|---|---|
| surlorian | WHO MedNet |
| Synonyms | Source |
|---|---|
| Arm-210 | ChEMBL |
| ARM210 | ChEMBL |
| Rycal dmd | ChEMBL |
| S-48168 | ChEMBL |
| S48168 | ChEMBL |
| Citations |
|---|