EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:757905 - pruxelutamide
| Formula | C24H19F4N5O2S |
| Net Charge | 0 |
| Average Mass | 517.508 |
| Monoisotopic Mass | 517.11956 |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2F)C(=S)N1c1ccc(CCCc2ncco2)nc1 |
| InChI | InChI=1S/C24H19F4N5O2S/c1-23(2)21(34)32(17-9-6-14(12-29)19(20(17)25)24(26,27)28)22(36)33(23)16-8-7-15(31-13-16)4-3-5-18-30-10-11-35-18/h6-11,13H,3-5H2,1-2H3 |
| InChIKey | KCBJGVDOSBKVKP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pruxelutamide (CHEBI:757905) has role antineoplastic agent (CHEBI:35610) |
| pruxelutamide (CHEBI:757905) has role antiviral agent (CHEBI:22587) |
| pruxelutamide (CHEBI:757905) is a imidazolidines (CHEBI:38261) |
| INN | Source |
|---|---|
| pruxelutamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Gt-0918 | ChEMBL |
| Gt0918 | ChEMBL |
| Proxalutamide | ChEMBL |