EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:757903 - 1,1'-methylenebis(4-((hydroxyimino)methyl)-pyridinium) dimethanesulfonate
| Formula | CH3O3S.C13H14N4O2.CH3O3S |
| Net Charge | 0 |
| Average Mass | 448.479 |
| Monoisotopic Mass | 448.07226 |
| SMILES | CS(=O)(=O)[O-].CS(=O)(=O)[O-].ON=Cc1cc[n+](C[n+]2ccc(C=NO)cc2)cc1 |
| InChI | InChI=1S/C13H12N4O2.2CH4O3S/c18-14-9-12-1-5-16(6-2-12)11-17-7-3-13(4-8-17)10-15-19;2*1-5(2,3)4/h1-10H,11H2;2*1H3,(H,2,3,4) |
| InChIKey | LIBNJJLUCYWGII-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1'-methylenebis(4-((hydroxyimino)methyl)-pyridinium) dimethanesulfonate (CHEBI:757903) is a hydroxypyridine (CHEBI:24745) |
| Synonyms | Source |
|---|---|
| 1,1'-methylenebis(4-((hydroxyimino)methyl)-pyridinium) dimethanesulfonate | ChEMBL |
| Mmb-4 dimethanesulfonate | ChEMBL |
| Mmb4 dimethanesulfonate | ChEMBL |
| Mmb-4 dms | ChEMBL |
| Mmb4 dms | ChEMBL |