EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N3O5S |
| Net Charge | 0 |
| Average Mass | 415.471 |
| Monoisotopic Mass | 415.12019 |
| SMILES | CN1C(=O)C(C)(C)Oc2c(-c3cn(C)c(=O)c4nccc34)cc(S(C)(=O)=O)cc21 |
| InChI | InChI=1S/C20H21N3O5S/c1-20(2)19(25)23(4)15-9-11(29(5,26)27)8-13(17(15)28-20)14-10-22(3)18(24)16-12(14)6-7-21-16/h6-10,21H,1-5H3 |
| InChIKey | VZSAMEOETVNDQH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| incb-057643 (CHEBI:757900) has role antineoplastic agent (CHEBI:35610) |
| incb-057643 (CHEBI:757900) is a benzoxazine (CHEBI:46969) |
| Synonyms | Source |
|---|---|
| Incb-057643 | ChEMBL |
| INCB057643 | ChEMBL |