EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O4S.C24H33N3O4S |
| Net Charge | 0 |
| Average Mass | 557.691 |
| Monoisotopic Mass | 557.18656 |
| SMILES | COc1ccc(S(=O)(=O)NCc2cc(CN3CCCC3)c(O)c(CN3CCCC3)c2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C24H33N3O4S.H2O4S/c1-31-22-6-8-23(9-7-22)32(29,30)25-16-19-14-20(17-26-10-2-3-11-26)24(28)21(15-19)18-27-12-4-5-13-27;1-5(2,3)4/h6-9,14-15,25,28H,2-5,10-13,16-18H2,1H3;(H2,1,2,3,4) |
| InChIKey | BQCSIJGCWZAHPG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulcardine sulfate (CHEBI:757899) has role anti-arrhythmia drug (CHEBI:38070) |
| sulcardine sulfate (CHEBI:757899) is a sulfonamide (CHEBI:35358) |
| Synonyms | Source |
|---|---|
| HBI-3000 | ChEMBL |
| Sulcardine sulfate | ChEMBL |
| Sulcardine sulfate anhydrous | ChEMBL |