EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N3O3S |
| Net Charge | 0 |
| Average Mass | 373.478 |
| Monoisotopic Mass | 373.14601 |
| SMILES | CC1=CN2CCS(=O)(=O)N=C2C(c2ccc(OC3CCCCC3)cc2)=N1 |
| InChI | InChI=1S/C19H23N3O3S/c1-14-13-22-11-12-26(23,24)21-19(22)18(20-14)15-7-9-17(10-8-15)25-16-5-3-2-4-6-16/h7-10,13,16H,2-6,11-12H2,1H3 |
| InChIKey | PXJBHEHFVQVDDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osavampator (CHEBI:757892) has role antidepressant (CHEBI:35469) |
| osavampator (CHEBI:757892) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| osavampator | WHO MedNet |
| Synonym | Source |
|---|---|
| Tak-653 | ChEMBL |