EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H84N2O8 |
| Net Charge | 0 |
| Average Mass | 961.338 |
| Monoisotopic Mass | 960.62277 |
| SMILES | [H][C@]1([C@](C)(O)C(C)(C)C)C[C@@]23CC[C@]1(OC)[C@]1([H])Oc4c(OCCOc5ccc6c7c5O[C@@]5([H])[C@@]8(OC)CC[C@@]9(C[C@]8([H])[C@](C)(O)C(C)(C)C)[C@@H](C6)N(CC6CC6)CC[C@@]795)ccc5c4[C@]21CCN(CC1CC1)[C@@H]3C5 |
| InChI | InChI=1S/C60H84N2O8/c1-51(2,3)53(7,63)41-31-55-19-21-59(41,65-9)49-57(55)23-25-61(33-35-11-12-35)43(55)29-37-15-17-39(47(69-49)45(37)57)67-27-28-68-40-18-16-38-30-44-56-20-22-60(66-10,42(32-56)54(8,64)52(4,5)6)50-58(56,46(38)48(40)70-50)24-26-62(44)34-36-13-14-36/h15-18,35-36,41-44,49-50,63-64H,11-14,19-34H2,1-10H3/t41-,42-,43-,44-,49-,50-,53+,54+,55-,56-,57+,58+,59-,60-/m1/s1 |
| InChIKey | LEQOVFCHMOTJKU-WJVXOHEGSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orp-101 (CHEBI:757891) has role antispasmodic drug (CHEBI:53784) |
| orp-101 (CHEBI:757891) is a phenanthrenes (CHEBI:25961) |
| Synonyms | Source |
|---|---|
| Buprenorphine dimer | ChEMBL |
| Orp-101 | ChEMBL |