EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22N4O5 |
| Net Charge | 0 |
| Average Mass | 458.474 |
| Monoisotopic Mass | 458.15902 |
| SMILES | CC1=NN(c2ccc3c(c2)CCCC3)C(=O)/C1=N\Nc1cccc(-c2ccc(C(=O)O)o2)c1O |
| InChI | InChI=1S/C25H22N4O5/c1-14-22(24(31)29(28-14)17-10-9-15-5-2-3-6-16(15)13-17)27-26-19-8-4-7-18(23(19)30)20-11-12-21(34-20)25(32)33/h4,7-13,26,30H,2-3,5-6H2,1H3,(H,32,33)/b27-22- |
| InChIKey | BDGGFTDRPHKXFC-QYQHSDTDSA-N |
| Roles Classification |
|---|
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rafutrombopag (CHEBI:757890) has role anti-anaemic agent (CHEBI:75835) |
| rafutrombopag (CHEBI:757890) has role antineoplastic agent (CHEBI:35610) |
| rafutrombopag (CHEBI:757890) is a tetralins (CHEBI:36786) |
| INN | Source |
|---|---|
| rafutrombopag | WHO MedNet |
| Synonyms | Source |
|---|---|
| Hetrombopag | ChEMBL |
| SHR-8735 | ChEMBL |
| SHR8735 | ChEMBL |