EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38D6O2 |
| Net Charge | 0 |
| Average Mass | 406.684 |
| Monoisotopic Mass | 406.37179 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(O)(C([2H])([2H])[2H])C([2H])([2H])[2H])[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)CCC1=C |
| InChI | InChI=1S/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1,6-10,13-18H2,2-5H3/b21-11+,22-12-/t20-,23+,24-,25+,27-/m1/s1/i3D3,4D3 |
| InChIKey | JWUBBDSIWDLEOM-QFVHMXLQSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| d6-25-hydroxyvitamin d3 (CHEBI:757888) is a vitamin D (CHEBI:27300) |
| Synonyms | Source |
|---|---|
| Calcifediol-d6 | ChEMBL |
| D6-25-hydroxyvitamin d3 | ChEMBL |